C26H35NO2 — CID 90259001
(1S,9R,10R,12S)-12-(cyclopentylmethyl)-6-(cyclopropylmethyl)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one (PubChem CID 90259001) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is (1S,9R,10R,12S)-12-(cyclopentylmethyl)-6-(cyclopropylmethyl)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one.
| Compound Name | (1S,9R,10R,12S)-12-(cyclopentylmethyl)-6-(cyclopropylmethyl)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one |
|---|---|
| PubChem CID | 90259001 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (1S,9R,10R,12S)-12-(cyclopentylmethyl)-6-(cyclopropylmethyl)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one |
| SMILES | O=C1C[C@]23CCN[C@H](Cc4c(CC5CC5)cc(O)cc42)[C@@H]3C[C@@H]1CC1CCCC1 |
| InChI | InChI=1S/C26H35NO2/c28-20-11-18(9-17-5-6-17)21-14-24-23-12-19(10-16-3-1-2-4-16)25(29)15-26(23,7-8-27-24)22(21)13-20/h11,13,16-17,19,23-24,27-28H,1-10,12,14-15H2/t19-,23-,24+,26+/m0/s1 |
| InChIKey | GXPUGCGAODEAMV-WJSZZSSJSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |