C17H30F3NO4 — CID 90259253
(3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-(4,4,4-trifluorobutoxy)oxonan-2-one (PubChem CID 90259253) has the molecular formula C17H30F3NO4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-(4,4,4-trifluorobutoxy)oxonan-2-one.
| Compound Name | (3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-(4,4,4-trifluorobutoxy)oxonan-2-one |
|---|---|
| PubChem CID | 90259253 |
| Molecular Formula | C17H30F3NO4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-(4,4,4-trifluorobutoxy)oxonan-2-one |
| SMILES | CC(C)CO[C@H]1CCC[C@H](N)C(=O)O[C@@H](C)[C@@H]1OCCCC(F)(F)F |
| InChI | InChI=1S/C17H30F3NO4/c1-11(2)10-24-14-7-4-6-13(21)16(22)25-12(3)15(14)23-9-5-8-17(18,19)20/h11-15H,4-10,21H2,1-3H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | ADQGUYPBSOBLGU-AJNGGQMLSA-N |
| XLogP | 3.20 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|