C19H13N3O4 — CID 90259373
1-benzoyl-3-(1H-indol-2-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 90259373) has the molecular formula C19H13N3O4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 1-benzoyl-3-(1H-indol-2-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzoyl-3-(1H-indol-2-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90259373 |
| Molecular Formula | C19H13N3O4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-benzoyl-3-(1H-indol-2-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2cc3ccccc3[nH]2)C(=O)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H13N3O4/c23-16-11-17(24)22(18(25)12-6-2-1-3-7-12)19(26)21(16)15-10-13-8-4-5-9-14(13)20-15/h1-10,20H,11H2 |
| InChIKey | AIOOQTOBIOZQFY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|