About 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione
1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione (PubChem CID 90259431) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione.
Molecular Properties
| Compound Name | 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione |
| PubChem CID | 90259431 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione |
| SMILES | O=C1NCCC12C(=O)N(C1CCNCC1)c1ccccc12 |
| InChI | InChI=1S/C16H19N3O2/c20-14-16(7-10-18-14)12-3-1-2-4-13(12)19(15(16)21)11-5-8-17-9-6-11/h1-4,11,17H,5-10H2,(H,18,20) |
| InChIKey | NZDAUWARJJKFHS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione?
The IUPAC name of 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione (CID 90259431) is 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione.
What is the SMILES notation for 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione?
The canonical SMILES for 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione is O=C1NCCC12C(=O)N(C1CCNCC1)c1ccccc12.
What is the InChIKey of 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione?
The InChIKey is NZDAUWARJJKFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2/c20-14-16(7-10-18-14)12-3-1-2-4-13(12)19(15(16)21)11-5-8-17-9-6-11/h1-4,11,17H,5-10H2,(H,18,20).
What are the key properties of 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione?
1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione has a molecular weight of 285.35 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-ylspiro[indole-3,3'-pyrrolidine]-2,2'-dione is sourced from PubChem (CID 90259431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).