C19H19AsN6OS — CID 90259834
CID 90259834 (PubChem CID 90259834) has the molecular formula C19H19AsN6OS and a molecular weight of 454.39 g/mol.
| Compound Name | CID 90259834 |
|---|---|
| PubChem CID | 90259834 |
| Molecular Formula | C19H19AsN6OS |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | — |
| SMILES | COc1cccc2c1nc([As])n1nc(CN3Cc4nc(C(C)C)sc4C3)nc21 |
| InChI | InChI=1S/C19H19AsN6OS/c1-10(2)18-21-12-7-25(8-14(12)28-18)9-15-22-17-11-5-4-6-13(27-3)16(11)23-19(20)26(17)24-15/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | IIQBNHZFDSBVCZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|