C22H35F3O8S — CID 90260041
1-O-[2-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]ethyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 90260041) has the molecular formula C22H35F3O8S and a molecular weight of 516.58 g/mol. Its IUPAC name is 1-O-[2-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]ethyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]ethyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 90260041 |
| Molecular Formula | C22H35F3O8S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 1-O-[2-[(2-methyl-3-oxobutyl)sulfanylmethoxycarbonyloxy]ethyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCOC(=O)OCSCC(C)C(C)=O)C(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C22H35F3O8S/c1-7-21(6,18(28)30-9-8-22(23,24)25)13-20(4,5)17(27)31-10-11-32-19(29)33-14-34-12-15(2)16(3)26/h15H,7-14H2,1-6H3 |
| InChIKey | PVBPPPSEKWLALA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|