C30H36N4O5 — CID 90260769
(1S,4R,6S,7Z,18S,22R)-20-(1-methylindole-2-carbonyl)-2,15-dioxo-3,16,20-triazatetracyclo[14.6.0.04,6.018,22]docos-7-ene-4-carboxylic acid (PubChem CID 90260769) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is (1S,4R,6S,7Z,18S,22R)-20-(1-methylindole-2-carbonyl)-2,15-dioxo-3,16,20-triazatetracyclo[14.6.0.04,6.018,22]docos-7-ene-4-carboxylic acid.
| Compound Name | (1S,4R,6S,7Z,18S,22R)-20-(1-methylindole-2-carbonyl)-2,15-dioxo-3,16,20-triazatetracyclo[14.6.0.04,6.018,22]docos-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 90260769 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (1S,4R,6S,7Z,18S,22R)-20-(1-methylindole-2-carbonyl)-2,15-dioxo-3,16,20-triazatetracyclo[14.6.0.04,6.018,22]docos-7-ene-4-carboxylic acid |
| SMILES | Cn1c(C(=O)N2C[C@H]3CN4C(=O)CCCCCC/C=C\[C@@H]5C[C@@]5(C(=O)O)NC(=O)[C@@H]4[C@H]3C2)cc2ccccc21 |
| InChI | InChI=1S/C30H36N4O5/c1-32-23-12-9-8-10-19(23)14-24(32)28(37)33-16-20-17-34-25(35)13-7-5-3-2-4-6-11-21-15-30(21,29(38)39)31-27(36)26(34)22(20)18-33/h6,8-12,14,20-22,26H,2-5,7,13,15-18H2,1H3,(H,31,36)(H,38,39)/b11-6-/t20-,21+,22-,26-,30+/m0/s1 |
| InChIKey | UNPZAQNIYIBNLR-GVACIBQHSA-N |
| XLogP | 2.95 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|