C15H26O — CID 90260929
9,9-dimethyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroxanthene (PubChem CID 90260929) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 9,9-dimethyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroxanthene.
| Compound Name | 9,9-dimethyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroxanthene |
|---|---|
| PubChem CID | 90260929 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 9,9-dimethyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroxanthene |
| SMILES | CC1(C)C2CCCCC2OC2CCCCC21 |
| InChI | InChI=1S/C15H26O/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h11-14H,3-10H2,1-2H3 |
| InChIKey | AAEDQZFFIBMKRF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |