C24H30N6O2 — CID 90261327
N-[(2E,4E)-5-amino-1-oxo-4-(2-piperazin-1-ylpyrimidin-4-yl)penta-2,4-dien-2-yl]-4-tert-butylbenzamide (PubChem CID 90261327) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[(2E,4E)-5-amino-1-oxo-4-(2-piperazin-1-ylpyrimidin-4-yl)penta-2,4-dien-2-yl]-4-tert-butylbenzamide.
| Compound Name | N-[(2E,4E)-5-amino-1-oxo-4-(2-piperazin-1-ylpyrimidin-4-yl)penta-2,4-dien-2-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 90261327 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[(2E,4E)-5-amino-1-oxo-4-(2-piperazin-1-ylpyrimidin-4-yl)penta-2,4-dien-2-yl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N/C(C=O)=C/C(=C\N)c2ccnc(N3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C24H30N6O2/c1-24(2,3)19-6-4-17(5-7-19)22(32)28-20(16-31)14-18(15-25)21-8-9-27-23(29-21)30-12-10-26-11-13-30/h4-9,14-16,26H,10-13,25H2,1-3H3,(H,28,32)/b18-15+,20-14+ |
| InChIKey | QFEGHWBRBMLPMG-IWSLWXFRSA-N |
| XLogP | 2.00 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|