C10H13N5O — CID 90261402
(2E,4E)-2,5-diamino-4-[6-(methylamino)pyrazin-2-yl]penta-2,4-dienal (PubChem CID 90261402) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is (2E,4E)-2,5-diamino-4-[6-(methylamino)pyrazin-2-yl]penta-2,4-dienal.
| Compound Name | (2E,4E)-2,5-diamino-4-[6-(methylamino)pyrazin-2-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 90261402 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (2E,4E)-2,5-diamino-4-[6-(methylamino)pyrazin-2-yl]penta-2,4-dienal |
| SMILES | CNc1cncc(C(/C=C(/N)C=O)=C/N)n1 |
| InChI | InChI=1S/C10H13N5O/c1-13-10-5-14-4-9(15-10)7(3-11)2-8(12)6-16/h2-6H,11-12H2,1H3,(H,13,15)/b7-3+,8-2+ |
| InChIKey | PJIRZWJKOWBGOI-VPVKMOQPSA-N |
| XLogP | -0.14 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|