C21H31NO — CID 90261562
(S)-[(1R)-2-ethyl-3-methylcyclohexa-2,4-dien-1-yl]-[[3-[(E,2S)-pent-3-en-2-yl]cyclohexa-2,4-dien-1-yl]amino]methanol (PubChem CID 90261562) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (S)-[(1R)-2-ethyl-3-methylcyclohexa-2,4-dien-1-yl]-[[3-[(E,2S)-pent-3-en-2-yl]cyclohexa-2,4-dien-1-yl]amino]methanol.
| Compound Name | (S)-[(1R)-2-ethyl-3-methylcyclohexa-2,4-dien-1-yl]-[[3-[(E,2S)-pent-3-en-2-yl]cyclohexa-2,4-dien-1-yl]amino]methanol |
|---|---|
| PubChem CID | 90261562 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (S)-[(1R)-2-ethyl-3-methylcyclohexa-2,4-dien-1-yl]-[[3-[(E,2S)-pent-3-en-2-yl]cyclohexa-2,4-dien-1-yl]amino]methanol |
| SMILES | C/C=C/[C@H](C)C1=CC(N[C@@H](O)[C@@H]2CC=CC(C)=C2CC)CC=C1 |
| InChI | InChI=1S/C21H31NO/c1-5-9-15(3)17-11-8-12-18(14-17)22-21(23)20-13-7-10-16(4)19(20)6-2/h5,7-11,14-15,18,20-23H,6,12-13H2,1-4H3/b9-5+/t15-,18?,20+,21-/m0/s1 |
| InChIKey | LAEUGYLJZWRIHU-KWUKUOJZSA-N |
| XLogP | 4.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|