C25H26N4O5 — CID 90261583
N-[[2-(1-amino-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-tert-butylbenzamide (PubChem CID 90261583) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-[[2-(1-amino-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-tert-butylbenzamide.
| Compound Name | N-[[2-(1-amino-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 90261583 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[[2-(1-amino-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccc3c(c2)C(=O)N(C2CCC(=O)N(N)C2=O)C3=O)cc1 |
| InChI | InChI=1S/C25H26N4O5/c1-25(2,3)16-7-5-15(6-8-16)21(31)27-13-14-4-9-17-18(12-14)23(33)28(22(17)32)19-10-11-20(30)29(26)24(19)34/h4-9,12,19H,10-11,13,26H2,1-3H3,(H,27,31) |
| InChIKey | PSMMCPRQNFFUCP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|