C26H22F5N5O3 — CID 90262114
1-methyl-4-[3-methyl-2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one (PubChem CID 90262114) has the molecular formula C26H22F5N5O3 and a molecular weight of 547.48 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 90262114 |
| Molecular Formula | C26H22F5N5O3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one |
| SMILES | CC(=NOCc1c(F)c(F)c(F)c(F)c1F)c1ccc(OCc2c(C)cccc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C26H22F5N5O3/c1-13-6-5-7-19(36-26(37)35(4)33-34-36)17(13)11-38-20-9-8-16(10-14(20)2)15(3)32-39-12-18-21(27)23(29)25(31)24(30)22(18)28/h5-10H,11-12H2,1-4H3 |
| InChIKey | RTOYIWSRMYFCAL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|