C18H17BrN4O3 — CID 90262178
1-[2-[(4-acetyl-2-bromophenoxy)methyl]-3-methylphenyl]-4-methyltetrazol-5-one (PubChem CID 90262178) has the molecular formula C18H17BrN4O3 and a molecular weight of 417.26 g/mol. Its IUPAC name is 1-[2-[(4-acetyl-2-bromophenoxy)methyl]-3-methylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(4-acetyl-2-bromophenoxy)methyl]-3-methylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 90262178 |
| Molecular Formula | C18H17BrN4O3 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-[2-[(4-acetyl-2-bromophenoxy)methyl]-3-methylphenyl]-4-methyltetrazol-5-one |
| SMILES | CC(=O)c1ccc(OCc2c(C)cccc2-n2nnn(C)c2=O)c(Br)c1 |
| InChI | InChI=1S/C18H17BrN4O3/c1-11-5-4-6-16(23-18(25)22(3)20-21-23)14(11)10-26-17-8-7-13(12(2)24)9-15(17)19/h4-9H,10H2,1-3H3 |
| InChIKey | FWPPLLHMKCTBGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |