C11H5F19O2 — CID 90262461
2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxymethyl]-1,1,1,2,3,3,4,4,5,5-decafluorohexane (PubChem CID 90262461) has the molecular formula C11H5F19O2 and a molecular weight of 530.12 g/mol. Its IUPAC name is 2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxymethyl]-1,1,1,2,3,3,4,4,5,5-decafluorohexane.
| Compound Name | 2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxymethyl]-1,1,1,2,3,3,4,4,5,5-decafluorohexane |
|---|---|
| PubChem CID | 90262461 |
| Molecular Formula | C11H5F19O2 |
| Molecular Weight | 530.12 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | 2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxymethyl]-1,1,1,2,3,3,4,4,5,5-decafluorohexane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OCF |
| InChI | InChI=1S/C11H5F19O2/c1-3(13,14)5(16,17)6(18,19)4(15,8(21,22)23)10(27,28)32-7(20,9(24,25)26)11(29,30)31-2-12/h2H2,1H3 |
| InChIKey | XGOSNNLMXYRNPD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.12 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|