C60H46F2N2O3 — CID 90262726
5-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-5-N,9-N-bis(4-fluorophenyl)naphtho[2,1-b][1]benzofuran-5,9-diamine (PubChem CID 90262726) has the molecular formula C60H46F2N2O3 and a molecular weight of 881.04 g/mol. Its IUPAC name is 5-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-5-N,9-N-bis(4-fluorophenyl)naphtho[2,1-b][1]benzofuran-5,9-diamine.
| Compound Name | 5-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-5-N,9-N-bis(4-fluorophenyl)naphtho[2,1-b][1]benzofuran-5,9-diamine |
|---|---|
| PubChem CID | 90262726 |
| Molecular Formula | C60H46F2N2O3 |
| Molecular Weight | 881.04 g/mol |
| Exact Mass | 880.35 |
| IUPAC Name | 5-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-5-N,9-N-bis(4-fluorophenyl)naphtho[2,1-b][1]benzofuran-5,9-diamine |
| SMILES | CC(C)(C)c1cccc2c1oc1c(N(c3ccc(F)cc3)c3ccc4c(c3)oc3cc(N(c5ccc(F)cc5)c5cccc6c5oc5c(C(C)(C)C)cccc56)c5ccccc5c34)cccc12 |
| InChI | InChI=1S/C60H46F2N2O3/c1-59(2,3)47-19-9-15-42-44-17-11-21-49(57(44)66-55(42)47)63(37-27-23-35(61)24-28-37)39-31-32-46-52(33-39)65-53-34-51(40-13-7-8-14-41(40)54(46)53)64(38-29-25-36(62)26-30-38)50-22-12-18-45-43-16-10-20-48(60(4,5)6)56(43)67-58(45)50/h7-34H,1-6H3 |
| InChIKey | BONVXMVNUIFYSB-UHFFFAOYSA-N |
| XLogP | 18.35 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.04 |
| LogP ≤ 5 | 18.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |