C17H18FN5O3S — CID 9026299
(2S)-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide (PubChem CID 9026299) has the molecular formula C17H18FN5O3S and a molecular weight of 391.43 g/mol. Its IUPAC name is (2S)-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 9026299 |
| Molecular Formula | C17H18FN5O3S |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2S)-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
| SMILES | C[C@H](Sc1nnc(C2CC2)n1C1CC1)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18FN5O3S/c1-9(16(24)19-11-4-7-13(18)14(8-11)23(25)26)27-17-21-20-15(10-2-3-10)22(17)12-5-6-12/h4,7-10,12H,2-3,5-6H2,1H3,(H,19,24)/t9-/m0/s1 |
| InChIKey | WOZOUTWZCPDDAO-VIFPVBQESA-N |
| XLogP | 3.66 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|