C34H29F2N — CID 90263970
N-tert-butyl-2-fluoro-N-(2-fluorophenyl)-5-phenyl-4-(3-phenylphenyl)aniline (PubChem CID 90263970) has the molecular formula C34H29F2N and a molecular weight of 489.61 g/mol. Its IUPAC name is N-tert-butyl-2-fluoro-N-(2-fluorophenyl)-5-phenyl-4-(3-phenylphenyl)aniline.
| Compound Name | N-tert-butyl-2-fluoro-N-(2-fluorophenyl)-5-phenyl-4-(3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 90263970 |
| Molecular Formula | C34H29F2N |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-tert-butyl-2-fluoro-N-(2-fluorophenyl)-5-phenyl-4-(3-phenylphenyl)aniline |
| SMILES | CC(C)(C)N(c1ccccc1F)c1cc(-c2ccccc2)c(-c2cccc(-c3ccccc3)c2)cc1F |
| InChI | InChI=1S/C34H29F2N/c1-34(2,3)37(32-20-11-10-19-30(32)35)33-23-29(25-15-8-5-9-16-25)28(22-31(33)36)27-18-12-17-26(21-27)24-13-6-4-7-14-24/h4-23H,1-3H3 |
| InChIKey | DPXALQIFOAVSLV-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |