C24H27N3O4S — CID 90264308
(1S,4S,7S,9R)-16-(benzenesulfonyl)-4-ethyl-9-propyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 90264308) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is (1S,4S,7S,9R)-16-(benzenesulfonyl)-4-ethyl-9-propyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7S,9R)-16-(benzenesulfonyl)-4-ethyl-9-propyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 90264308 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (1S,4S,7S,9R)-16-(benzenesulfonyl)-4-ethyl-9-propyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CCC[C@]12C[C@H]3C(=O)N[C@@H](CC)C(=O)N3[C@H]1N(S(=O)(=O)c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C24H27N3O4S/c1-3-14-24-15-20-21(28)25-18(4-2)22(29)26(20)23(24)27(19-13-9-8-12-17(19)24)32(30,31)16-10-6-5-7-11-16/h5-13,18,20,23H,3-4,14-15H2,1-2H3,(H,25,28)/t18-,20-,23-,24+/m0/s1 |
| InChIKey | WRAZPZXEUAGJDC-SFTZYOPASA-N |
| XLogP | 2.77 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |