C19H29NO4 — CID 90265293
(3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-phenoxyoxonan-2-one (PubChem CID 90265293) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-phenoxyoxonan-2-one.
| Compound Name | (3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-phenoxyoxonan-2-one |
|---|---|
| PubChem CID | 90265293 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (3S,7S,8S,9S)-3-amino-9-methyl-7-(2-methylpropoxy)-8-phenoxyoxonan-2-one |
| SMILES | CC(C)CO[C@H]1CCC[C@H](N)C(=O)O[C@@H](C)[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-13(2)12-22-17-11-7-10-16(20)19(21)23-14(3)18(17)24-15-8-5-4-6-9-15/h4-6,8-9,13-14,16-18H,7,10-12,20H2,1-3H3/t14-,16-,17-,18-/m0/s1 |
| InChIKey | INNXYYSYSTXZOB-DKIMLUQUSA-N |
| XLogP | 2.92 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |