C25H30N3O7P — CID 90266362
[(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl dibutyl phosphate (PubChem CID 90266362) has the molecular formula C25H30N3O7P and a molecular weight of 515.50 g/mol. Its IUPAC name is [(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl dibutyl phosphate.
| Compound Name | [(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl dibutyl phosphate |
|---|---|
| PubChem CID | 90266362 |
| Molecular Formula | C25H30N3O7P |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | [(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl dibutyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)OC[C@@H]1OC(=O)N2c3ccc(-c4ccc(C#N)nc4)cc3OC[C@@H]12 |
| InChI | InChI=1S/C25H30N3O7P/c1-3-5-11-32-36(30,33-12-6-4-2)34-17-24-22-16-31-23-13-18(19-7-9-20(14-26)27-15-19)8-10-21(23)28(22)25(29)35-24/h7-10,13,15,22,24H,3-6,11-12,16-17H2,1-2H3/t22-,24-/m0/s1 |
| InChIKey | JWNSCUPVTPOSHE-UPVQGACJSA-N |
| XLogP | 5.46 |
| TPSA | 120.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|