C8H6O6 — CID 90266402
10-hydroxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione (PubChem CID 90266402) has the molecular formula C8H6O6 and a molecular weight of 198.13 g/mol. Its IUPAC name is 10-hydroxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione.
| Compound Name | 10-hydroxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 90266402 |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 10-hydroxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione |
| SMILES | O=C1OC(=O)C2C1C1C(=O)OC(O)C21 |
| InChI | InChI=1S/C8H6O6/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-5,9H |
| InChIKey | KUYUMJCLIMPLRQ-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|