C12H19F5O2 — CID 90266536
[2-ethyl-3,3-difluoro-2,4-dimethyl-4-(trifluoromethyl)hexyl] formate (PubChem CID 90266536) has the molecular formula C12H19F5O2 and a molecular weight of 290.27 g/mol. Its IUPAC name is [2-ethyl-3,3-difluoro-2,4-dimethyl-4-(trifluoromethyl)hexyl] formate.
| Compound Name | [2-ethyl-3,3-difluoro-2,4-dimethyl-4-(trifluoromethyl)hexyl] formate |
|---|---|
| PubChem CID | 90266536 |
| Molecular Formula | C12H19F5O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [2-ethyl-3,3-difluoro-2,4-dimethyl-4-(trifluoromethyl)hexyl] formate |
| SMILES | CCC(C)(COC=O)C(F)(F)C(C)(CC)C(F)(F)F |
| InChI | InChI=1S/C12H19F5O2/c1-5-9(3,7-19-8-18)11(13,14)10(4,6-2)12(15,16)17/h8H,5-7H2,1-4H3 |
| InChIKey | LBEAMZUJARTCRI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|