C15H20O3 — CID 90266543
10'-hydroxyspiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one (PubChem CID 90266543) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 10'-hydroxyspiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one.
| Compound Name | 10'-hydroxyspiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one |
|---|---|
| PubChem CID | 90266543 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 10'-hydroxyspiro[oxolane-3,4'-tetracyclo[6.2.1.13,6.02,7]dodecane]-2-one |
| SMILES | O=C1OCCC12CC1CC2C2C3CC(CC3O)C12 |
| InChI | InChI=1S/C15H20O3/c16-11-5-7-3-9(11)13-10-4-8(12(7)13)6-15(10)1-2-18-14(15)17/h7-13,16H,1-6H2 |
| InChIKey | BUYVWQKIMBFLLJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|