C25H20F5N5O3 — CID 90266889
1-methyl-4-[2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one (PubChem CID 90266889) has the molecular formula C25H20F5N5O3 and a molecular weight of 533.46 g/mol. Its IUPAC name is 1-methyl-4-[2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 90266889 |
| Molecular Formula | C25H20F5N5O3 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 1-methyl-4-[2-[[2-methyl-4-[C-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one |
| SMILES | CC(=NOCc1c(F)c(F)c(F)c(F)c1F)c1ccc(OCc2ccccc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C25H20F5N5O3/c1-13-10-15(14(2)31-38-12-17-20(26)22(28)24(30)23(29)21(17)27)8-9-19(13)37-11-16-6-4-5-7-18(16)35-25(36)34(3)32-33-35/h4-10H,11-12H2,1-3H3 |
| InChIKey | YWRAETRARIDMDR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|