About (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine
(2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine (PubChem CID 90268007) has the molecular formula C13H21FN2
and a molecular weight of 224.32 g/mol. Its IUPAC name is (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine.
Molecular Properties
| Compound Name | (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine |
| PubChem CID | 90268007 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine |
| SMILES | CC1CC(N2CCN(C)[C@H](C)C2)=CC=C1F |
| InChI | InChI=1S/C13H21FN2/c1-10-8-12(4-5-13(10)14)16-7-6-15(3)11(2)9-16/h4-5,10-11H,6-9H2,1-3H3/t10?,11-/m1/s1 |
| InChIKey | HVTYGAYZMNOKPY-RRKGBCIJSA-N |
| XLogP | 2.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine?
The IUPAC name of (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine (CID 90268007) is (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine.
What is the SMILES notation for (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine?
The canonical SMILES for (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine is CC1CC(N2CCN(C)[C@H](C)C2)=CC=C1F.
What is the InChIKey of (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine?
The InChIKey is HVTYGAYZMNOKPY-RRKGBCIJSA-N. The full InChI is InChI=1S/C13H21FN2/c1-10-8-12(4-5-13(10)14)16-7-6-15(3)11(2)9-16/h4-5,10-11H,6-9H2,1-3H3/t10?,11-/m1/s1.
What are the key properties of (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine?
(2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine has a molecular weight of 224.32 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-1,2-dimethylpiperazine is sourced from PubChem (CID 90268007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).