C27H38N4O4 — CID 90268155
2-[(E)-1-[4-[1-[(1R,3R)-3-methylcyclononyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid (PubChem CID 90268155) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[(E)-1-[4-[1-[(1R,3R)-3-methylcyclononyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-1-[4-[1-[(1R,3R)-3-methylcyclononyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 90268155 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-[(E)-1-[4-[1-[(1R,3R)-3-methylcyclononyl]piperidin-4-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid |
| SMILES | C/C(=N\OCC(=O)O)c1nc2ccccc2n(C2CCN([C@@H]3CCCCCC[C@@H](C)C3)CC2)c1=O |
| InChI | InChI=1S/C27H38N4O4/c1-19-9-5-3-4-6-10-22(17-19)30-15-13-21(14-16-30)31-24-12-8-7-11-23(24)28-26(27(31)34)20(2)29-35-18-25(32)33/h7-8,11-12,19,21-22H,3-6,9-10,13-18H2,1-2H3,(H,32,33)/b29-20+/t19-,22-/m1/s1 |
| InChIKey | DMUVVMQCVJKYJV-OOGBLEIGSA-N |
| XLogP | 4.61 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|