C31H46N4O4 — CID 90268345
2-[(E)-1-[3-oxo-4-[(2R)-2-propyl-1-[2-[(1S,2S)-2,3,3-trimethylcyclohexyl]ethyl]piperidin-4-yl]quinoxalin-2-yl]ethylideneamino]oxyacetic acid (PubChem CID 90268345) has the molecular formula C31H46N4O4 and a molecular weight of 538.73 g/mol. Its IUPAC name is 2-[(E)-1-[3-oxo-4-[(2R)-2-propyl-1-[2-[(1S,2S)-2,3,3-trimethylcyclohexyl]ethyl]piperidin-4-yl]quinoxalin-2-yl]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-1-[3-oxo-4-[(2R)-2-propyl-1-[2-[(1S,2S)-2,3,3-trimethylcyclohexyl]ethyl]piperidin-4-yl]quinoxalin-2-yl]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 90268345 |
| Molecular Formula | C31H46N4O4 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 2-[(E)-1-[3-oxo-4-[(2R)-2-propyl-1-[2-[(1S,2S)-2,3,3-trimethylcyclohexyl]ethyl]piperidin-4-yl]quinoxalin-2-yl]ethylideneamino]oxyacetic acid |
| SMILES | CCC[C@@H]1CC(n2c(=O)c(/C(C)=N/OCC(=O)O)nc3ccccc32)CCN1CC[C@@H]1CCCC(C)(C)[C@H]1C |
| InChI | InChI=1S/C31H46N4O4/c1-6-10-24-19-25(15-18-34(24)17-14-23-11-9-16-31(4,5)21(23)2)35-27-13-8-7-12-26(27)32-29(30(35)38)22(3)33-39-20-28(36)37/h7-8,12-13,21,23-25H,6,9-11,14-20H2,1-5H3,(H,36,37)/b33-22+/t21-,23-,24+,25?/m0/s1 |
| InChIKey | PJIJDVHHIJGBBC-WZZUCYRQSA-N |
| XLogP | 5.88 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|