About (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate
(1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate (PubChem CID 90268423) has the molecular formula C25H39NO3
and a molecular weight of 401.59 g/mol. Its IUPAC name is (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate.
Molecular Properties
| Compound Name | (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate |
| PubChem CID | 90268423 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate |
| SMILES | CCC1(OC(=O)N(CCc2ccccc2)OC2(CC)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C25H39NO3/c1-3-24(17-10-6-11-18-24)28-23(27)26(21-16-22-14-8-5-9-15-22)29-25(4-2)19-12-7-13-20-25/h5,8-9,14-15H,3-4,6-7,10-13,16-21H2,1-2H3 |
| InChIKey | BYUSBARWLBCWCR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate?
The IUPAC name of (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate (CID 90268423) is (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate.
What is the SMILES notation for (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate?
The canonical SMILES for (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate is CCC1(OC(=O)N(CCc2ccccc2)OC2(CC)CCCCC2)CCCCC1.
What is the InChIKey of (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate?
The InChIKey is BYUSBARWLBCWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H39NO3/c1-3-24(17-10-6-11-18-24)28-23(27)26(21-16-22-14-8-5-9-15-22)29-25(4-2)19-12-7-13-20-25/h5,8-9,14-15H,3-4,6-7,10-13,16-21H2,1-2H3.
What are the key properties of (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate?
(1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate has a molecular weight of 401.59 g/mol, XLogP of 6.83, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexyl) N-(1-ethylcyclohexyl)oxy-N-(2-phenylethyl)carbamate is sourced from PubChem (CID 90268423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).