C9H5N5 — CID 90269055
2,5,6,10,11-pentazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene (PubChem CID 90269055) has the molecular formula C9H5N5 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2,5,6,10,11-pentazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 2,5,6,10,11-pentazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 90269055 |
| Molecular Formula | C9H5N5 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2,5,6,10,11-pentazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene |
| SMILES | c1cnnc2cc3nncc3nc2c1 |
| InChI | InChI=1S/C9H5N5/c1-2-6-7(13-10-3-1)4-8-9(12-6)5-11-14-8/h1-5H |
| InChIKey | LIXRXUVSRGSJTF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |