C10H15ClN2O5S — CID 90269474
methyl (3aR,5S,6S,7R,7aR)-2-[chloro(ethyl)amino]-6,7-dihydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-5-carboxylate (PubChem CID 90269474) has the molecular formula C10H15ClN2O5S and a molecular weight of 310.76 g/mol. Its IUPAC name is methyl (3aR,5S,6S,7R,7aR)-2-[chloro(ethyl)amino]-6,7-dihydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-5-carboxylate.
| Compound Name | methyl (3aR,5S,6S,7R,7aR)-2-[chloro(ethyl)amino]-6,7-dihydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 90269474 |
| Molecular Formula | C10H15ClN2O5S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | methyl (3aR,5S,6S,7R,7aR)-2-[chloro(ethyl)amino]-6,7-dihydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-5-carboxylate |
| SMILES | CCN(Cl)C1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(=O)OC)O[C@@H]2S1 |
| InChI | InChI=1S/C10H15ClN2O5S/c1-3-13(11)10-12-4-5(14)6(15)7(8(16)17-2)18-9(4)19-10/h4-7,9,14-15H,3H2,1-2H3/t4-,5-,6+,7+,9-/m1/s1 |
| InChIKey | NLOFASHQGWOZEJ-CRYJZLASSA-N |
| XLogP | -0.45 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|