C29H36N2 — CID 90269809
N-[(Z)-[(3R,4bR)-9-hept-6-enyl-2,3,4b,5,6,8a-hexahydrocarbazol-3-yl]-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine (PubChem CID 90269809) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is N-[(Z)-[(3R,4bR)-9-hept-6-enyl-2,3,4b,5,6,8a-hexahydrocarbazol-3-yl]-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine.
| Compound Name | N-[(Z)-[(3R,4bR)-9-hept-6-enyl-2,3,4b,5,6,8a-hexahydrocarbazol-3-yl]-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine |
|---|---|
| PubChem CID | 90269809 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | N-[(Z)-[(3R,4bR)-9-hept-6-enyl-2,3,4b,5,6,8a-hexahydrocarbazol-3-yl]-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]ethanimine |
| SMILES | C=CCCCCCN1C2=CC[C@@H](C(/N=C/C)=c3\ccccc3=C)C=C2[C@H]2CCC=CC21 |
| InChI | InChI=1S/C29H36N2/c1-4-6-7-8-13-20-31-27-17-12-11-16-25(27)26-21-23(18-19-28(26)31)29(30-5-2)24-15-10-9-14-22(24)3/h4-5,9-10,12,14-15,17,19,21,23,25,27H,1,3,6-8,11,13,16,18,20H2,2H3/b29-24-,30-5+/t23-,25-,27?/m1/s1 |
| InChIKey | IVCBHCJAVPIZFL-ZFLZCNHJSA-N |
| XLogP | 5.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|