About (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene
(7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene (PubChem CID 90269863) has the molecular formula C10H10S
and a molecular weight of 162.26 g/mol. Its IUPAC name is (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene.
Molecular Properties
| Compound Name | (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene |
| PubChem CID | 90269863 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene |
| SMILES | C=C1S[C@@H]2C=CC=CC2C1=C |
| InChI | InChI=1S/C10H10S/c1-7-8(2)11-10-6-4-3-5-9(7)10/h3-6,9-10H,1-2H2/t9?,10-/m1/s1 |
| InChIKey | JCJLOBJQHNIGEH-QVDQXJPCSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene?
The IUPAC name of (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene (CID 90269863) is (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene.
What is the SMILES notation for (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene?
The canonical SMILES for (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene is C=C1S[C@@H]2C=CC=CC2C1=C.
What is the InChIKey of (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene?
The InChIKey is JCJLOBJQHNIGEH-QVDQXJPCSA-N. The full InChI is InChI=1S/C10H10S/c1-7-8(2)11-10-6-4-3-5-9(7)10/h3-6,9-10H,1-2H2/t9?,10-/m1/s1.
What are the key properties of (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene?
(7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene has a molecular weight of 162.26 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7aR)-2,3-dimethylidene-3a,7a-dihydro-1-benzothiophene is sourced from PubChem (CID 90269863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).