C24H34N2O5 — CID 90270864
tert-butyl 4-[3-(2-acetyloxybutyl)-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate (PubChem CID 90270864) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl 4-[3-(2-acetyloxybutyl)-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2-acetyloxybutyl)-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90270864 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | tert-butyl 4-[3-(2-acetyloxybutyl)-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate |
| SMILES | CCC(CC1C(=O)N(C2CCN(C(=O)OC(C)(C)C)CC2)c2ccccc21)OC(C)=O |
| InChI | InChI=1S/C24H34N2O5/c1-6-18(30-16(2)27)15-20-19-9-7-8-10-21(19)26(22(20)28)17-11-13-25(14-12-17)23(29)31-24(3,4)5/h7-10,17-18,20H,6,11-15H2,1-5H3 |
| InChIKey | USLUTFJBDQIOOG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |