C27H40O2 — CID 90271016
(1S,2R,10S,11S,14S,15S)-15-acetyl-10,14-dimethylhexacyclo[12.9.0.02,11.05,10.015,22.016,21]tricosan-7-one (PubChem CID 90271016) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is (1S,2R,10S,11S,14S,15S)-15-acetyl-10,14-dimethylhexacyclo[12.9.0.02,11.05,10.015,22.016,21]tricosan-7-one.
| Compound Name | (1S,2R,10S,11S,14S,15S)-15-acetyl-10,14-dimethylhexacyclo[12.9.0.02,11.05,10.015,22.016,21]tricosan-7-one |
|---|---|
| PubChem CID | 90271016 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (1S,2R,10S,11S,14S,15S)-15-acetyl-10,14-dimethylhexacyclo[12.9.0.02,11.05,10.015,22.016,21]tricosan-7-one |
| SMILES | CC(=O)[C@@]12C3CCCCC3C1C[C@H]1[C@@H]3CCC4CC(=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C27H40O2/c1-16(28)27-22-7-5-4-6-19(22)24(27)15-23-20-9-8-17-14-18(29)10-12-25(17,2)21(20)11-13-26(23,27)3/h17,19-24H,4-15H2,1-3H3/t17?,19?,20-,21+,22?,23+,24?,25+,26+,27-/m1/s1 |
| InChIKey | YDHYILIBTQNHSX-VDKYVHNVSA-N |
| XLogP | 6.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |