C14H12BN3O5 — CID 90271067
2-hydroxy-3-(pyrimidine-5-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 90271067) has the molecular formula C14H12BN3O5 and a molecular weight of 313.08 g/mol. Its IUPAC name is 2-hydroxy-3-(pyrimidine-5-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-(pyrimidine-5-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 90271067 |
| Molecular Formula | C14H12BN3O5 |
| Molecular Weight | 313.08 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-hydroxy-3-(pyrimidine-5-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(NC1Cc2cccc(C(=O)O)c2OB1O)c1cncnc1 |
| InChI | InChI=1S/C14H12BN3O5/c19-13(9-5-16-7-17-6-9)18-11-4-8-2-1-3-10(14(20)21)12(8)23-15(11)22/h1-3,5-7,11,22H,4H2,(H,18,19)(H,20,21) |
| InChIKey | OQGUPXPWULVSPM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.08 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|