C11H11BN2O6 — CID 90271137
2-hydroxy-3-(oxamoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 90271137) has the molecular formula C11H11BN2O6 and a molecular weight of 278.03 g/mol. Its IUPAC name is 2-hydroxy-3-(oxamoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-(oxamoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 90271137 |
| Molecular Formula | C11H11BN2O6 |
| Molecular Weight | 278.03 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-hydroxy-3-(oxamoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NC(=O)C(=O)NC1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C11H11BN2O6/c13-9(15)10(16)14-7-4-5-2-1-3-6(11(17)18)8(5)20-12(7)19/h1-3,7,19H,4H2,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | QZTJDQIFHNMCJU-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.03 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|