C37H46ClN7O2Si — CID 90271189
2-(5-chloro-2-methylphenyl)-5-[2-(methylamino)-5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]pyrimidin-4-yl]-1-(3-trimethylsilylpropoxymethyl)pyrrole-3-carboxamide (PubChem CID 90271189) has the molecular formula C37H46ClN7O2Si and a molecular weight of 684.36 g/mol. Its IUPAC name is 2-(5-chloro-2-methylphenyl)-5-[2-(methylamino)-5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]pyrimidin-4-yl]-1-(3-trimethylsilylpropoxymethyl)pyrrole-3-carboxamide.
| Compound Name | 2-(5-chloro-2-methylphenyl)-5-[2-(methylamino)-5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]pyrimidin-4-yl]-1-(3-trimethylsilylpropoxymethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90271189 |
| Molecular Formula | C37H46ClN7O2Si |
| Molecular Weight | 684.36 g/mol |
| Exact Mass | 683.32 |
| IUPAC Name | 2-(5-chloro-2-methylphenyl)-5-[2-(methylamino)-5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]pyrimidin-4-yl]-1-(3-trimethylsilylpropoxymethyl)pyrrole-3-carboxamide |
| SMILES | CNc1ncc(C#Cc2ccc(N3CCN(C)CC3)cc2)c(-c2cc(C(N)=O)c(-c3cc(Cl)ccc3C)n2COCCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C37H46ClN7O2Si/c1-26-8-13-29(38)22-31(26)35-32(36(39)46)23-33(45(35)25-47-20-7-21-48(4,5)6)34-28(24-41-37(40-2)42-34)12-9-27-10-14-30(15-11-27)44-18-16-43(3)17-19-44/h8,10-11,13-15,22-24H,7,16-21,25H2,1-6H3,(H2,39,46)(H,40,41,42) |
| InChIKey | HPMWSWIAEPBWJR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.36 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|