C19H18BNO5 — CID 90271259
2-hydroxy-3-[(1-phenylcyclopropanecarbonyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 90271259) has the molecular formula C19H18BNO5 and a molecular weight of 351.17 g/mol. Its IUPAC name is 2-hydroxy-3-[(1-phenylcyclopropanecarbonyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-3-[(1-phenylcyclopropanecarbonyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 90271259 |
| Molecular Formula | C19H18BNO5 |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-hydroxy-3-[(1-phenylcyclopropanecarbonyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)C(NC(=O)C1(c3ccccc3)CC1)C2 |
| InChI | InChI=1S/C19H18BNO5/c22-17(23)14-8-4-5-12-11-15(20(25)26-16(12)14)21-18(24)19(9-10-19)13-6-2-1-3-7-13/h1-8,15,25H,9-11H2,(H,21,24)(H,22,23) |
| InChIKey | SAGXGVJLUIMZIU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|