C22H34N3O6P — CID 90271622
4-N,4-N-dibutylbenzene-1,4-diamine;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate (PubChem CID 90271622) has the molecular formula C22H34N3O6P and a molecular weight of 467.50 g/mol. Its IUPAC name is 4-N,4-N-dibutylbenzene-1,4-diamine;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate.
| Compound Name | 4-N,4-N-dibutylbenzene-1,4-diamine;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90271622 |
| Molecular Formula | C22H34N3O6P |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-N,4-N-dibutylbenzene-1,4-diamine;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate |
| SMILES | CCCCN(CCCC)c1ccc(N)cc1.Cc1ncc(COP(=O)(O)O)c(C=O)c1O |
| InChI | InChI=1S/C14H24N2.C8H10NO6P/c1-3-5-11-16(12-6-4-2)14-9-7-13(15)8-10-14;1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h7-10H,3-6,11-12,15H2,1-2H3;2-3,11H,4H2,1H3,(H2,12,13,14) |
| InChIKey | QPNOMITUGYVNSW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 146.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|