About dichlorozinc;methanidylbenzene;hydrobromide
dichlorozinc;methanidylbenzene;hydrobromide (PubChem CID 90272356) has the molecular formula C7H8BrCl2Zn-
and a molecular weight of 308.34 g/mol. Its IUPAC name is dichlorozinc;methanidylbenzene;hydrobromide.
Molecular Properties
| Compound Name | dichlorozinc;methanidylbenzene;hydrobromide |
| PubChem CID | 90272356 |
| Molecular Formula | C7H8BrCl2Zn- |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 304.85 |
| IUPAC Name | dichlorozinc;methanidylbenzene;hydrobromide |
| SMILES | Br.Cl[Zn]Cl.[CH2-]c1ccccc1 |
| InChI | InChI=1S/C7H7.BrH.2ClH.Zn/c1-7-5-3-2-4-6-7;;;;/h2-6H,1H2;3*1H;/q-1;;;;+2/p-2 |
| InChIKey | OEAUOOOROXPALU-UHFFFAOYSA-L |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;methanidylbenzene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;methanidylbenzene;hydrobromide?
The IUPAC name of dichlorozinc;methanidylbenzene;hydrobromide (CID 90272356) is dichlorozinc;methanidylbenzene;hydrobromide.
What is the SMILES notation for dichlorozinc;methanidylbenzene;hydrobromide?
The canonical SMILES for dichlorozinc;methanidylbenzene;hydrobromide is Br.Cl[Zn]Cl.[CH2-]c1ccccc1.
What is the InChIKey of dichlorozinc;methanidylbenzene;hydrobromide?
The InChIKey is OEAUOOOROXPALU-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H7.BrH.2ClH.Zn/c1-7-5-3-2-4-6-7;;;;/h2-6H,1H2;3*1H;/q-1;;;;+2/p-2.
What are the key properties of dichlorozinc;methanidylbenzene;hydrobromide?
dichlorozinc;methanidylbenzene;hydrobromide has a molecular weight of 308.34 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;methanidylbenzene;hydrobromide is sourced from PubChem (CID 90272356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).