C15H30N2O3 — CID 90272623
methyl (2S)-2-[2-(1-tert-butylpiperidin-4-yl)ethylamino]-3-hydroxypropanoate (PubChem CID 90272623) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is methyl (2S)-2-[2-(1-tert-butylpiperidin-4-yl)ethylamino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[2-(1-tert-butylpiperidin-4-yl)ethylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 90272623 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | methyl (2S)-2-[2-(1-tert-butylpiperidin-4-yl)ethylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NCCC1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-15(2,3)17-9-6-12(7-10-17)5-8-16-13(11-18)14(19)20-4/h12-13,16,18H,5-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | WNPFQJRVRNMJCV-ZDUSSCGKSA-N |
| XLogP | 1.01 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |