C31H49N3O9 — CID 90273172
tert-butyl 2-[[(1R,2R)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]cyclohexyl]-[(2-hydroxy-5-nitrophenyl)methyl]amino]acetate (PubChem CID 90273172) has the molecular formula C31H49N3O9 and a molecular weight of 607.75 g/mol. Its IUPAC name is tert-butyl 2-[[(1R,2R)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]cyclohexyl]-[(2-hydroxy-5-nitrophenyl)methyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(1R,2R)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]cyclohexyl]-[(2-hydroxy-5-nitrophenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 90273172 |
| Molecular Formula | C31H49N3O9 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.35 |
| IUPAC Name | tert-butyl 2-[[(1R,2R)-2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]cyclohexyl]-[(2-hydroxy-5-nitrophenyl)methyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CC(=O)OC(C)(C)C)[C@@H]1CCCC[C@H]1N(CC(=O)OC(C)(C)C)Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C31H49N3O9/c1-29(2,3)41-26(36)18-32(17-21-16-22(34(39)40)14-15-25(21)35)23-12-10-11-13-24(23)33(19-27(37)42-30(4,5)6)20-28(38)43-31(7,8)9/h14-16,23-24,35H,10-13,17-20H2,1-9H3/t23-,24-/m1/s1 |
| InChIKey | VGUUBPQNNQBPEU-DNQXCXABSA-N |
| XLogP | 4.74 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|