About (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate
(6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate (PubChem CID 90273355) has the molecular formula C16H15BrO7S2
and a molecular weight of 463.33 g/mol. Its IUPAC name is (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate |
| PubChem CID | 90273355 |
| Molecular Formula | C16H15BrO7S2 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)OC1COc2ccc(S(C)(=O)=O)cc2O1 |
| InChI | InChI=1S/C16H15BrO7S2/c1-10-7-11(17)3-6-15(10)26(20,21)24-16-9-22-13-5-4-12(25(2,18)19)8-14(13)23-16/h3-8,16H,9H2,1-2H3 |
| InChIKey | NELZYLFVAMZQPE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate?
The IUPAC name of (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate (CID 90273355) is (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate.
What is the SMILES notation for (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate?
The canonical SMILES for (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate is Cc1cc(Br)ccc1S(=O)(=O)OC1COc2ccc(S(C)(=O)=O)cc2O1.
What is the InChIKey of (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate?
The InChIKey is NELZYLFVAMZQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO7S2/c1-10-7-11(17)3-6-15(10)26(20,21)24-16-9-22-13-5-4-12(25(2,18)19)8-14(13)23-16/h3-8,16H,9H2,1-2H3.
What are the key properties of (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate?
(6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate has a molecular weight of 463.33 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-3-yl) 4-bromo-2-methylbenzenesulfonate is sourced from PubChem (CID 90273355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).