About 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine
2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine (PubChem CID 90273635) has the molecular formula C17H13BrN2O
and a molecular weight of 341.21 g/mol. Its IUPAC name is 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine.
Molecular Properties
| Compound Name | 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine |
| PubChem CID | 90273635 |
| Molecular Formula | C17H13BrN2O |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine |
| SMILES | Cc1ccc2c(c1)OCn1c-2nc(Br)c1-c1ccccc1 |
| InChI | InChI=1S/C17H13BrN2O/c1-11-7-8-13-14(9-11)21-10-20-15(16(18)19-17(13)20)12-5-3-2-4-6-12/h2-9H,10H2,1H3 |
| InChIKey | MVJLQESNEXTESM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine?
The IUPAC name of 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine (CID 90273635) is 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine.
What is the SMILES notation for 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine?
The canonical SMILES for 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine is Cc1ccc2c(c1)OCn1c-2nc(Br)c1-c1ccccc1.
What is the InChIKey of 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine?
The InChIKey is MVJLQESNEXTESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2O/c1-11-7-8-13-14(9-11)21-10-20-15(16(18)19-17(13)20)12-5-3-2-4-6-12/h2-9H,10H2,1H3.
What are the key properties of 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine?
2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine has a molecular weight of 341.21 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-8-methyl-3-phenyl-5H-imidazo[1,2-c][1,3]benzoxazine is sourced from PubChem (CID 90273635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).