C40H20F6N4 — CID 90273810
9,23-bis[4-(trifluoromethyl)phenyl]-5,9,19,23-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),17(22),18,20,25,27-tetradecaene (PubChem CID 90273810) has the molecular formula C40H20F6N4 and a molecular weight of 670.62 g/mol. Its IUPAC name is 9,23-bis[4-(trifluoromethyl)phenyl]-5,9,19,23-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),17(22),18,20,25,27-tetradecaene.
| Compound Name | 9,23-bis[4-(trifluoromethyl)phenyl]-5,9,19,23-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),17(22),18,20,25,27-tetradecaene |
|---|---|
| PubChem CID | 90273810 |
| Molecular Formula | C40H20F6N4 |
| Molecular Weight | 670.62 g/mol |
| Exact Mass | 670.16 |
| IUPAC Name | 9,23-bis[4-(trifluoromethyl)phenyl]-5,9,19,23-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),17(22),18,20,25,27-tetradecaene |
| SMILES | FC(F)(F)c1ccc(-n2c3ccncc3c3c4ccc5cc6c(c7ccc(cc32)c4c57)c2cnccc2n6-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C40H20F6N4/c41-39(42,43)23-3-7-25(8-4-23)49-32-14-16-48-20-30(32)38-28-12-2-22-18-34-37(27-11-1-21(17-33(38)49)35(28)36(22)27)29-19-47-15-13-31(29)50(34)26-9-5-24(6-10-26)40(44,45)46/h1-20H |
| InChIKey | IZTFYIFPFONIRY-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.62 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|