C29H42BFO8 — CID 90274835
tert-butyl 6-fluoro-3-[(2R)-2-methoxy-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate (PubChem CID 90274835) has the molecular formula C29H42BFO8 and a molecular weight of 548.46 g/mol. Its IUPAC name is tert-butyl 6-fluoro-3-[(2R)-2-methoxy-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate.
| Compound Name | tert-butyl 6-fluoro-3-[(2R)-2-methoxy-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
|---|---|
| PubChem CID | 90274835 |
| Molecular Formula | C29H42BFO8 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | tert-butyl 6-fluoro-3-[(2R)-2-methoxy-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
| SMILES | CO[C@@H](Cc1ccc(F)c(C(=O)OC(C)(C)C)c1OC(=O)OC(C)(C)C)B1OC2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C29H42BFO8/c1-26(2,3)36-24(32)22-18(31)12-11-16(23(22)35-25(33)37-27(4,5)6)13-21(34-10)30-38-20-15-17-14-19(28(17,7)8)29(20,9)39-30/h11-12,17,19-21H,13-15H2,1-10H3/t17-,19-,20?,21-,29-/m0/s1 |
| InChIKey | KDTWFNCKWWHRDP-ULQMAQNSSA-N |
| XLogP | 5.92 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|