C24H32BNO6 — CID 90274844
4-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butanamide (PubChem CID 90274844) has the molecular formula C24H32BNO6 and a molecular weight of 441.33 g/mol. Its IUPAC name is 4-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butanamide.
| Compound Name | 4-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butanamide |
|---|---|
| PubChem CID | 90274844 |
| Molecular Formula | C24H32BNO6 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butanamide |
| SMILES | CC1(C)OC(=O)c2cccc(CC(CC(N)=O)B3OC4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)c2O1 |
| InChI | InChI=1S/C24H32BNO6/c1-22(2)14-10-17(22)24(5)18(11-14)31-25(32-24)15(12-19(26)27)9-13-7-6-8-16-20(13)29-23(3,4)30-21(16)28/h6-8,14-15,17-18H,9-12H2,1-5H3,(H2,26,27)/t14-,15?,17-,18?,24-/m0/s1 |
| InChIKey | HYKLLCXDVNBUBZ-BFCPLFLGSA-N |
| XLogP | 3.49 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|