C26H36BClO6S — CID 90274847
[2-acetyl-6-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-methylsulfanylphenyl] tert-butyl carbonate (PubChem CID 90274847) has the molecular formula C26H36BClO6S and a molecular weight of 522.90 g/mol. Its IUPAC name is [2-acetyl-6-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-methylsulfanylphenyl] tert-butyl carbonate.
| Compound Name | [2-acetyl-6-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-methylsulfanylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 90274847 |
| Molecular Formula | C26H36BClO6S |
| Molecular Weight | 522.90 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [2-acetyl-6-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-methylsulfanylphenyl] tert-butyl carbonate |
| SMILES | CSc1ccc(C[C@@H](Cl)B2OC3CC4CC(C4(C)C)[C@]3(C)O2)c(OC(=O)OC(C)(C)C)c1C(C)=O |
| InChI | InChI=1S/C26H36BClO6S/c1-14(29)21-17(35-8)10-9-15(22(21)31-23(30)32-24(2,3)4)11-20(28)27-33-19-13-16-12-18(25(16,5)6)26(19,7)34-27/h9-10,16,18-20H,11-13H2,1-8H3/t16?,18?,19?,20-,26+/m1/s1 |
| InChIKey | QJEZLUBBFZTCBV-ZEIRRPQVSA-N |
| XLogP | 6.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.90 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|