C21H26BrN3O3 — CID 90274925
6-[(2-bromophenyl)methyl]-9-butoxy-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione (PubChem CID 90274925) has the molecular formula C21H26BrN3O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is 6-[(2-bromophenyl)methyl]-9-butoxy-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione.
| Compound Name | 6-[(2-bromophenyl)methyl]-9-butoxy-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
|---|---|
| PubChem CID | 90274925 |
| Molecular Formula | C21H26BrN3O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 6-[(2-bromophenyl)methyl]-9-butoxy-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
| SMILES | CCCCOc1c2n(c(Cc3ccccc3Br)nc1=O)CCN(C(C)C)C2=O |
| InChI | InChI=1S/C21H26BrN3O3/c1-4-5-12-28-19-18-21(27)24(14(2)3)10-11-25(18)17(23-20(19)26)13-15-8-6-7-9-16(15)22/h6-9,14H,4-5,10-13H2,1-3H3 |
| InChIKey | WFJWAUPQQIYGGK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|